C19H27N3O — CID 97277235
(6S)-1-benzyl-4-(3-pyrrol-1-ylpropyl)-1,4-diazepan-6-ol (PubChem CID 97277235) has the molecular formula C19H27N3O and a molecular weight of 313.44 g/mol. Its IUPAC name is (6S)-1-benzyl-4-(3-pyrrol-1-ylpropyl)-1,4-diazepan-6-ol.
| Compound Name | (6S)-1-benzyl-4-(3-pyrrol-1-ylpropyl)-1,4-diazepan-6-ol |
|---|---|
| PubChem CID | 97277235 |
| Molecular Formula | C19H27N3O |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.22 |
| IUPAC Name | (6S)-1-benzyl-4-(3-pyrrol-1-ylpropyl)-1,4-diazepan-6-ol |
| SMILES | O[C@H]1CN(CCCn2cccc2)CCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C19H27N3O/c23-19-16-21(12-6-11-20-9-4-5-10-20)13-14-22(17-19)15-18-7-2-1-3-8-18/h1-5,7-10,19,23H,6,11-17H2/t19-/m0/s1 |
| InChIKey | YYTZJBGXVVAQHK-IBGZPJMESA-N |
| XLogP | 2.06 |
| TPSA | 31.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |