C20H22N4O2 — CID 97278250
(6R)-1-benzyl-4-(3-phenyl-1,2,4-oxadiazol-5-yl)-1,4-diazepan-6-ol (PubChem CID 97278250) has the molecular formula C20H22N4O2 and a molecular weight of 350.42 g/mol. Its IUPAC name is (6R)-1-benzyl-4-(3-phenyl-1,2,4-oxadiazol-5-yl)-1,4-diazepan-6-ol.
| Compound Name | (6R)-1-benzyl-4-(3-phenyl-1,2,4-oxadiazol-5-yl)-1,4-diazepan-6-ol |
|---|---|
| PubChem CID | 97278250 |
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | (6R)-1-benzyl-4-(3-phenyl-1,2,4-oxadiazol-5-yl)-1,4-diazepan-6-ol |
| SMILES | O[C@@H]1CN(Cc2ccccc2)CCN(c2nc(-c3ccccc3)no2)C1 |
| InChI | InChI=1S/C20H22N4O2/c25-18-14-23(13-16-7-3-1-4-8-16)11-12-24(15-18)20-21-19(22-26-20)17-9-5-2-6-10-17/h1-10,18,25H,11-15H2/t18-/m1/s1 |
| InChIKey | WYIXTENBERBBMT-GOSISDBHSA-N |
| XLogP | 2.42 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |