C17H20FN3O — CID 97281064
(6R)-1-benzyl-4-(3-fluoro-2-pyridinyl)-1,4-diazepan-6-ol (PubChem CID 97281064) has the molecular formula C17H20FN3O and a molecular weight of 301.37 g/mol. Its IUPAC name is (6R)-1-benzyl-4-(3-fluoro-2-pyridinyl)-1,4-diazepan-6-ol.
| Compound Name | (6R)-1-benzyl-4-(3-fluoro-2-pyridinyl)-1,4-diazepan-6-ol |
|---|---|
| PubChem CID | 97281064 |
| Molecular Formula | C17H20FN3O |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | (6R)-1-benzyl-4-(3-fluoro-2-pyridinyl)-1,4-diazepan-6-ol |
| SMILES | O[C@@H]1CN(Cc2ccccc2)CCN(c2ncccc2F)C1 |
| InChI | InChI=1S/C17H20FN3O/c18-16-7-4-8-19-17(16)21-10-9-20(12-15(22)13-21)11-14-5-2-1-3-6-14/h1-8,15,22H,9-13H2/t15-/m1/s1 |
| InChIKey | YLDRQIDEAGXDAU-OAHLLOKOSA-N |
| XLogP | 1.90 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |