C18H23N3O — CID 72919693
1-benzyl-4-(4-methyl-2-pyridinyl)-1,4-diazepan-6-ol (PubChem CID 72919693) has the molecular formula C18H23N3O and a molecular weight of 297.40 g/mol. Its IUPAC name is 1-benzyl-4-(4-methyl-2-pyridinyl)-1,4-diazepan-6-ol.
| Compound Name | 1-benzyl-4-(4-methyl-2-pyridinyl)-1,4-diazepan-6-ol |
|---|---|
| PubChem CID | 72919693 |
| Molecular Formula | C18H23N3O |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | 1-benzyl-4-(4-methyl-2-pyridinyl)-1,4-diazepan-6-ol |
| SMILES | Cc1ccnc(N2CCN(Cc3ccccc3)CC(O)C2)c1 |
| InChI | InChI=1S/C18H23N3O/c1-15-7-8-19-18(11-15)21-10-9-20(13-17(22)14-21)12-16-5-3-2-4-6-16/h2-8,11,17,22H,9-10,12-14H2,1H3 |
| InChIKey | UEGLEDPCAGEOKB-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |