C19H22F3N3O — CID 72860692
1-benzyl-4-[6-methyl-4-(trifluoromethyl)-2-pyridinyl]-1,4-diazepan-6-ol (PubChem CID 72860692) has the molecular formula C19H22F3N3O and a molecular weight of 365.40 g/mol. Its IUPAC name is 1-benzyl-4-[6-methyl-4-(trifluoromethyl)-2-pyridinyl]-1,4-diazepan-6-ol.
| Compound Name | 1-benzyl-4-[6-methyl-4-(trifluoromethyl)-2-pyridinyl]-1,4-diazepan-6-ol |
|---|---|
| PubChem CID | 72860692 |
| Molecular Formula | C19H22F3N3O |
| Molecular Weight | 365.40 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | 1-benzyl-4-[6-methyl-4-(trifluoromethyl)-2-pyridinyl]-1,4-diazepan-6-ol |
| SMILES | Cc1cc(C(F)(F)F)cc(N2CCN(Cc3ccccc3)CC(O)C2)n1 |
| InChI | InChI=1S/C19H22F3N3O/c1-14-9-16(19(20,21)22)10-18(23-14)25-8-7-24(12-17(26)13-25)11-15-5-3-2-4-6-15/h2-6,9-10,17,26H,7-8,11-13H2,1H3 |
| InChIKey | MEUDHHLHCMALLD-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.40 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |