C15H17NOS3 — CID 139658202
5-[4-hydroxy-3-(piperidin-1-ylmethyl)phenyl]dithiole-3-thione (PubChem CID 139658202) has the molecular formula C15H17NOS3 and a molecular weight of 323.51 g/mol. Its IUPAC name is 5-[4-hydroxy-3-(piperidin-1-ylmethyl)phenyl]dithiole-3-thione.
| Compound Name | 5-[4-hydroxy-3-(piperidin-1-ylmethyl)phenyl]dithiole-3-thione |
|---|---|
| PubChem CID | 139658202 |
| Molecular Formula | C15H17NOS3 |
| Molecular Weight | 323.51 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | 5-[4-hydroxy-3-(piperidin-1-ylmethyl)phenyl]dithiole-3-thione |
| SMILES | Oc1ccc(-c2cc(=S)ss2)cc1CN1CCCCC1 |
| InChI | InChI=1S/C15H17NOS3/c17-13-5-4-11(14-9-15(18)20-19-14)8-12(13)10-16-6-2-1-3-7-16/h4-5,8-9,17H,1-3,6-7,10H2 |
| InChIKey | SXHLGAUPYRTNIU-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.51 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|