C16H20N2O2S3 — CID 139658139
5-[4-hydroxy-3-[[4-(2-hydroxyethyl)piperazin-1-yl]methyl]phenyl]dithiole-3-thione (PubChem CID 139658139) has the molecular formula C16H20N2O2S3 and a molecular weight of 368.55 g/mol. Its IUPAC name is 5-[4-hydroxy-3-[[4-(2-hydroxyethyl)piperazin-1-yl]methyl]phenyl]dithiole-3-thione.
| Compound Name | 5-[4-hydroxy-3-[[4-(2-hydroxyethyl)piperazin-1-yl]methyl]phenyl]dithiole-3-thione |
|---|---|
| PubChem CID | 139658139 |
| Molecular Formula | C16H20N2O2S3 |
| Molecular Weight | 368.55 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | 5-[4-hydroxy-3-[[4-(2-hydroxyethyl)piperazin-1-yl]methyl]phenyl]dithiole-3-thione |
| SMILES | OCCN1CCN(Cc2cc(-c3cc(=S)ss3)ccc2O)CC1 |
| InChI | InChI=1S/C16H20N2O2S3/c19-8-7-17-3-5-18(6-4-17)11-13-9-12(1-2-14(13)20)15-10-16(21)23-22-15/h1-2,9-10,19-20H,3-8,11H2 |
| InChIKey | ZRINFOWKNNACGJ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.55 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|