C22H24N2OS3 — CID 139657926
5-[4-hydroxy-3-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]-4-phenyldithiole-3-thione (PubChem CID 139657926) has the molecular formula C22H24N2OS3 and a molecular weight of 428.65 g/mol. Its IUPAC name is 5-[4-hydroxy-3-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]-4-phenyldithiole-3-thione.
| Compound Name | 5-[4-hydroxy-3-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]-4-phenyldithiole-3-thione |
|---|---|
| PubChem CID | 139657926 |
| Molecular Formula | C22H24N2OS3 |
| Molecular Weight | 428.65 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | 5-[4-hydroxy-3-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]-4-phenyldithiole-3-thione |
| SMILES | CN1CCCN(Cc2cc(-c3ssc(=S)c3-c3ccccc3)ccc2O)CC1 |
| InChI | InChI=1S/C22H24N2OS3/c1-23-10-5-11-24(13-12-23)15-18-14-17(8-9-19(18)25)21-20(22(26)28-27-21)16-6-3-2-4-7-16/h2-4,6-9,14,25H,5,10-13,15H2,1H3 |
| InChIKey | WBFDJFABXUPQFI-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.65 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|