C28H37ClN4OS3 — CID 139658080
4-[4-hydroxy-3,5-bis[(4-methylpiperazin-1-yl)methyl]phenyl]-5-(4-methylphenyl)dithiole-3-thione;hydrochloride (PubChem CID 139658080) has the molecular formula C28H37ClN4OS3 and a molecular weight of 577.29 g/mol. Its IUPAC name is 4-[4-hydroxy-3,5-bis[(4-methylpiperazin-1-yl)methyl]phenyl]-5-(4-methylphenyl)dithiole-3-thione;hydrochloride.
| Compound Name | 4-[4-hydroxy-3,5-bis[(4-methylpiperazin-1-yl)methyl]phenyl]-5-(4-methylphenyl)dithiole-3-thione;hydrochloride |
|---|---|
| PubChem CID | 139658080 |
| Molecular Formula | C28H37ClN4OS3 |
| Molecular Weight | 577.29 g/mol |
| Exact Mass | 576.18 |
| IUPAC Name | 4-[4-hydroxy-3,5-bis[(4-methylpiperazin-1-yl)methyl]phenyl]-5-(4-methylphenyl)dithiole-3-thione;hydrochloride |
| SMILES | Cc1ccc(-c2ssc(=S)c2-c2cc(CN3CCN(C)CC3)c(O)c(CN3CCN(C)CC3)c2)cc1.Cl |
| InChI | InChI=1S/C28H36N4OS3.ClH/c1-20-4-6-21(7-5-20)27-25(28(34)36-35-27)22-16-23(18-31-12-8-29(2)9-13-31)26(33)24(17-22)19-32-14-10-30(3)11-15-32;/h4-7,16-17,33H,8-15,18-19H2,1-3H3;1H |
| InChIKey | JOADAUNCVIJVTO-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 33.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.29 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|