C31H34N2O4S3 — CID 139658237
5-[4-hydroxy-3-[[4-[(2,3,5-trimethoxyphenyl)methyl]piperazin-1-yl]methyl]phenyl]-4-(4-methylphenyl)dithiole-3-thione (PubChem CID 139658237) has the molecular formula C31H34N2O4S3 and a molecular weight of 594.82 g/mol. Its IUPAC name is 5-[4-hydroxy-3-[[4-[(2,3,5-trimethoxyphenyl)methyl]piperazin-1-yl]methyl]phenyl]-4-(4-methylphenyl)dithiole-3-thione.
| Compound Name | 5-[4-hydroxy-3-[[4-[(2,3,5-trimethoxyphenyl)methyl]piperazin-1-yl]methyl]phenyl]-4-(4-methylphenyl)dithiole-3-thione |
|---|---|
| PubChem CID | 139658237 |
| Molecular Formula | C31H34N2O4S3 |
| Molecular Weight | 594.82 g/mol |
| Exact Mass | 594.17 |
| IUPAC Name | 5-[4-hydroxy-3-[[4-[(2,3,5-trimethoxyphenyl)methyl]piperazin-1-yl]methyl]phenyl]-4-(4-methylphenyl)dithiole-3-thione |
| SMILES | COc1cc(CN2CCN(Cc3cc(-c4ssc(=S)c4-c4ccc(C)cc4)ccc3O)CC2)c(OC)c(OC)c1 |
| InChI | InChI=1S/C31H34N2O4S3/c1-20-5-7-21(8-6-20)28-30(39-40-31(28)38)22-9-10-26(34)23(15-22)18-32-11-13-33(14-12-32)19-24-16-25(35-2)17-27(36-3)29(24)37-4/h5-10,15-17,34H,11-14,18-19H2,1-4H3 |
| InChIKey | DSMBKXSENLIALU-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 54.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.82 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|