C22H24N2O2S3 — CID 139658251
5-[4-hydroxy-3-[[4-[(4-methoxyphenyl)methyl]piperazin-1-yl]methyl]phenyl]dithiole-3-thione (PubChem CID 139658251) has the molecular formula C22H24N2O2S3 and a molecular weight of 444.65 g/mol. Its IUPAC name is 5-[4-hydroxy-3-[[4-[(4-methoxyphenyl)methyl]piperazin-1-yl]methyl]phenyl]dithiole-3-thione.
| Compound Name | 5-[4-hydroxy-3-[[4-[(4-methoxyphenyl)methyl]piperazin-1-yl]methyl]phenyl]dithiole-3-thione |
|---|---|
| PubChem CID | 139658251 |
| Molecular Formula | C22H24N2O2S3 |
| Molecular Weight | 444.65 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | 5-[4-hydroxy-3-[[4-[(4-methoxyphenyl)methyl]piperazin-1-yl]methyl]phenyl]dithiole-3-thione |
| SMILES | COc1ccc(CN2CCN(Cc3cc(-c4cc(=S)ss4)ccc3O)CC2)cc1 |
| InChI | InChI=1S/C22H24N2O2S3/c1-26-19-5-2-16(3-6-19)14-23-8-10-24(11-9-23)15-18-12-17(4-7-20(18)25)21-13-22(27)29-28-21/h2-7,12-13,25H,8-11,14-15H2,1H3 |
| InChIKey | SEYWXRYHTZJGRY-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.65 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|