C17H21NOS3 — CID 139657994
5-[4-hydroxy-3-(pyrrolidin-1-ylmethyl)phenyl]-4-propyldithiole-3-thione (PubChem CID 139657994) has the molecular formula C17H21NOS3 and a molecular weight of 351.56 g/mol. Its IUPAC name is 5-[4-hydroxy-3-(pyrrolidin-1-ylmethyl)phenyl]-4-propyldithiole-3-thione.
| Compound Name | 5-[4-hydroxy-3-(pyrrolidin-1-ylmethyl)phenyl]-4-propyldithiole-3-thione |
|---|---|
| PubChem CID | 139657994 |
| Molecular Formula | C17H21NOS3 |
| Molecular Weight | 351.56 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | 5-[4-hydroxy-3-(pyrrolidin-1-ylmethyl)phenyl]-4-propyldithiole-3-thione |
| SMILES | CCCc1c(-c2ccc(O)c(CN3CCCC3)c2)ssc1=S |
| InChI | InChI=1S/C17H21NOS3/c1-2-5-14-16(21-22-17(14)20)12-6-7-15(19)13(10-12)11-18-8-3-4-9-18/h6-7,10,19H,2-5,8-9,11H2,1H3 |
| InChIKey | NMXOZJQRUCFXPU-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.56 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|