C26H40N4O3S3 — CID 139658130
5-[4-hydroxy-3,5-bis[[4-(3-hydroxypropyl)piperazin-1-yl]methyl]phenyl]-4-methyldithiole-3-thione (PubChem CID 139658130) has the molecular formula C26H40N4O3S3 and a molecular weight of 552.83 g/mol. Its IUPAC name is 5-[4-hydroxy-3,5-bis[[4-(3-hydroxypropyl)piperazin-1-yl]methyl]phenyl]-4-methyldithiole-3-thione.
| Compound Name | 5-[4-hydroxy-3,5-bis[[4-(3-hydroxypropyl)piperazin-1-yl]methyl]phenyl]-4-methyldithiole-3-thione |
|---|---|
| PubChem CID | 139658130 |
| Molecular Formula | C26H40N4O3S3 |
| Molecular Weight | 552.83 g/mol |
| Exact Mass | 552.23 |
| IUPAC Name | 5-[4-hydroxy-3,5-bis[[4-(3-hydroxypropyl)piperazin-1-yl]methyl]phenyl]-4-methyldithiole-3-thione |
| SMILES | Cc1c(-c2cc(CN3CCN(CCCO)CC3)c(O)c(CN3CCN(CCCO)CC3)c2)ssc1=S |
| InChI | InChI=1S/C26H40N4O3S3/c1-20-25(35-36-26(20)34)21-16-22(18-29-10-6-27(7-11-29)4-2-14-31)24(33)23(17-21)19-30-12-8-28(9-13-30)5-3-15-32/h16-17,31-33H,2-15,18-19H2,1H3 |
| InChIKey | ZUZAAQWDXAEFKU-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 73.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.83 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|