C26H38N2O3S3 — CID 139658119
5-[4-hydroxy-3,5-bis[[2-(2-hydroxyethyl)piperidin-1-yl]methyl]phenyl]-4-methyldithiole-3-thione (PubChem CID 139658119) has the molecular formula C26H38N2O3S3 and a molecular weight of 522.80 g/mol. Its IUPAC name is 5-[4-hydroxy-3,5-bis[[2-(2-hydroxyethyl)piperidin-1-yl]methyl]phenyl]-4-methyldithiole-3-thione.
| Compound Name | 5-[4-hydroxy-3,5-bis[[2-(2-hydroxyethyl)piperidin-1-yl]methyl]phenyl]-4-methyldithiole-3-thione |
|---|---|
| PubChem CID | 139658119 |
| Molecular Formula | C26H38N2O3S3 |
| Molecular Weight | 522.80 g/mol |
| Exact Mass | 522.20 |
| IUPAC Name | 5-[4-hydroxy-3,5-bis[[2-(2-hydroxyethyl)piperidin-1-yl]methyl]phenyl]-4-methyldithiole-3-thione |
| SMILES | Cc1c(-c2cc(CN3CCCCC3CCO)c(O)c(CN3CCCCC3CCO)c2)ssc1=S |
| InChI | InChI=1S/C26H38N2O3S3/c1-18-25(33-34-26(18)32)19-14-20(16-27-10-4-2-6-22(27)8-12-29)24(31)21(15-19)17-28-11-5-3-7-23(28)9-13-30/h14-15,22-23,29-31H,2-13,16-17H2,1H3 |
| InChIKey | LSTYLOMEHBIJMX-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 67.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.80 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|