C24H22ClN5O — CID 135858729
4-(7-chloroquinolin-4-yl)-2-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]phenol (PubChem CID 135858729) has the molecular formula C24H22ClN5O and a molecular weight of 431.93 g/mol. Its IUPAC name is 4-(7-chloroquinolin-4-yl)-2-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]phenol.
| Compound Name | 4-(7-chloroquinolin-4-yl)-2-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]phenol |
|---|---|
| PubChem CID | 135858729 |
| Molecular Formula | C24H22ClN5O |
| Molecular Weight | 431.93 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | 4-(7-chloroquinolin-4-yl)-2-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]phenol |
| SMILES | Oc1ccc(-c2ccnc3cc(Cl)ccc23)cc1CN1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C24H22ClN5O/c25-19-3-4-21-20(6-9-26-22(21)15-19)17-2-5-23(31)18(14-17)16-29-10-12-30(13-11-29)24-27-7-1-8-28-24/h1-9,14-15,31H,10-13,16H2 |
| InChIKey | DYACCYSJGNAUBV-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.93 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|