C25H30Cl2N4 — CID 46852980
7-chloro-4-[[4-(4-phenylpiperazin-1-yl)piperidin-1-yl]methyl]quinoline;hydrochloride (PubChem CID 46852980) has the molecular formula C25H30Cl2N4 and a molecular weight of 457.45 g/mol. Its IUPAC name is 7-chloro-4-[[4-(4-phenylpiperazin-1-yl)piperidin-1-yl]methyl]quinoline;hydrochloride.
| Compound Name | 7-chloro-4-[[4-(4-phenylpiperazin-1-yl)piperidin-1-yl]methyl]quinoline;hydrochloride |
|---|---|
| PubChem CID | 46852980 |
| Molecular Formula | C25H30Cl2N4 |
| Molecular Weight | 457.45 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | 7-chloro-4-[[4-(4-phenylpiperazin-1-yl)piperidin-1-yl]methyl]quinoline;hydrochloride |
| SMILES | Cl.Clc1ccc2c(CN3CCC(N4CCN(c5ccccc5)CC4)CC3)ccnc2c1 |
| InChI | InChI=1S/C25H29ClN4.ClH/c26-21-6-7-24-20(8-11-27-25(24)18-21)19-28-12-9-23(10-13-28)30-16-14-29(15-17-30)22-4-2-1-3-5-22;/h1-8,11,18,23H,9-10,12-17,19H2;1H |
| InChIKey | VMLUXWKTNOOXCR-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 22.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.45 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |