C19H25ClN4 — CID 133315656
7-chloro-4-[4-(1-methylpiperidin-3-yl)piperazin-1-yl]quinoline (PubChem CID 133315656) has the molecular formula C19H25ClN4 and a molecular weight of 344.89 g/mol. Its IUPAC name is 7-chloro-4-[4-(1-methylpiperidin-3-yl)piperazin-1-yl]quinoline.
| Compound Name | 7-chloro-4-[4-(1-methylpiperidin-3-yl)piperazin-1-yl]quinoline |
|---|---|
| PubChem CID | 133315656 |
| Molecular Formula | C19H25ClN4 |
| Molecular Weight | 344.89 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 7-chloro-4-[4-(1-methylpiperidin-3-yl)piperazin-1-yl]quinoline |
| SMILES | CN1CCCC(N2CCN(c3ccnc4cc(Cl)ccc34)CC2)C1 |
| InChI | InChI=1S/C19H25ClN4/c1-22-8-2-3-16(14-22)23-9-11-24(12-10-23)19-6-7-21-18-13-15(20)4-5-17(18)19/h4-7,13,16H,2-3,8-12,14H2,1H3 |
| InChIKey | RJKNSEAKIJYULC-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 22.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.89 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |