C20H20ClN3O2 — CID 136967880
N-[2-[[5-(7-chloroquinolin-4-yl)-2-hydroxyphenyl]methylamino]ethyl]acetamide (PubChem CID 136967880) has the molecular formula C20H20ClN3O2 and a molecular weight of 369.85 g/mol. Its IUPAC name is N-[2-[[5-(7-chloroquinolin-4-yl)-2-hydroxyphenyl]methylamino]ethyl]acetamide.
| Compound Name | N-[2-[[5-(7-chloroquinolin-4-yl)-2-hydroxyphenyl]methylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 136967880 |
| Molecular Formula | C20H20ClN3O2 |
| Molecular Weight | 369.85 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | N-[2-[[5-(7-chloroquinolin-4-yl)-2-hydroxyphenyl]methylamino]ethyl]acetamide |
| SMILES | CC(=O)NCCNCc1cc(-c2ccnc3cc(Cl)ccc23)ccc1O |
| InChI | InChI=1S/C20H20ClN3O2/c1-13(25)23-9-8-22-12-15-10-14(2-5-20(15)26)17-6-7-24-19-11-16(21)3-4-18(17)19/h2-7,10-11,22,26H,8-9,12H2,1H3,(H,23,25) |
| InChIKey | BAYPCGRQPQRMML-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.85 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|