C10H12ClNO3 — CID 43139894
3-[(5-chloro-2-hydroxyphenyl)methylamino]propanoic acid (PubChem CID 43139894) has the molecular formula C10H12ClNO3 and a molecular weight of 229.66 g/mol. Its IUPAC name is 3-[(5-chloro-2-hydroxyphenyl)methylamino]propanoic acid.
| Compound Name | 3-[(5-chloro-2-hydroxyphenyl)methylamino]propanoic acid |
|---|---|
| PubChem CID | 43139894 |
| Molecular Formula | C10H12ClNO3 |
| Molecular Weight | 229.66 g/mol |
| Exact Mass | 229.05 |
| IUPAC Name | 3-[(5-chloro-2-hydroxyphenyl)methylamino]propanoic acid |
| SMILES | O=C(O)CCNCc1cc(Cl)ccc1O |
| InChI | InChI=1S/C10H12ClNO3/c11-8-1-2-9(13)7(5-8)6-12-4-3-10(14)15/h1-2,5,12-13H,3-4,6H2,(H,14,15) |
| InChIKey | UJZBSDKQMINISX-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.66 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|