C10H11ClFNO2 — CID 112652700
3-[(2-chloro-3-fluorophenyl)methylamino]propanoic acid (PubChem CID 112652700) has the molecular formula C10H11ClFNO2 and a molecular weight of 231.65 g/mol. Its IUPAC name is 3-[(2-chloro-3-fluorophenyl)methylamino]propanoic acid.
| Compound Name | 3-[(2-chloro-3-fluorophenyl)methylamino]propanoic acid |
|---|---|
| PubChem CID | 112652700 |
| Molecular Formula | C10H11ClFNO2 |
| Molecular Weight | 231.65 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | 3-[(2-chloro-3-fluorophenyl)methylamino]propanoic acid |
| SMILES | O=C(O)CCNCc1cccc(F)c1Cl |
| InChI | InChI=1S/C10H11ClFNO2/c11-10-7(2-1-3-8(10)12)6-13-5-4-9(14)15/h1-3,13H,4-6H2,(H,14,15) |
| InChIKey | PZNWBIWIHQJUNO-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.65 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|