C11H15NO3 — CID 112606379
3-[(2-hydroxy-3-methylphenyl)methylamino]propanoic acid (PubChem CID 112606379) has the molecular formula C11H15NO3 and a molecular weight of 209.25 g/mol. Its IUPAC name is 3-[(2-hydroxy-3-methylphenyl)methylamino]propanoic acid.
| Compound Name | 3-[(2-hydroxy-3-methylphenyl)methylamino]propanoic acid |
|---|---|
| PubChem CID | 112606379 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | 3-[(2-hydroxy-3-methylphenyl)methylamino]propanoic acid |
| SMILES | Cc1cccc(CNCCC(=O)O)c1O |
| InChI | InChI=1S/C11H15NO3/c1-8-3-2-4-9(11(8)15)7-12-6-5-10(13)14/h2-4,12,15H,5-7H2,1H3,(H,13,14) |
| InChIKey | DKTZXDGJBWZKQP-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|