C10H13NO4 — CID 43139941
3-[(3,4-dihydroxyphenyl)methylamino]propanoic acid (PubChem CID 43139941) has the molecular formula C10H13NO4 and a molecular weight of 211.22 g/mol. Its IUPAC name is 3-[(3,4-dihydroxyphenyl)methylamino]propanoic acid.
| Compound Name | 3-[(3,4-dihydroxyphenyl)methylamino]propanoic acid |
|---|---|
| PubChem CID | 43139941 |
| Molecular Formula | C10H13NO4 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 3-[(3,4-dihydroxyphenyl)methylamino]propanoic acid |
| SMILES | O=C(O)CCNCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C10H13NO4/c12-8-2-1-7(5-9(8)13)6-11-4-3-10(14)15/h1-2,5,11-13H,3-4,6H2,(H,14,15) |
| InChIKey | VMPIUEXJZMJNJT-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|