C23H23ClN2O6S — CID 16521159
[2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl] 2-chloro-5-morpholin-4-ylsulfonylbenzoate (PubChem CID 16521159) has the molecular formula C23H23ClN2O6S and a molecular weight of 490.97 g/mol. Its IUPAC name is [2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl] 2-chloro-5-morpholin-4-ylsulfonylbenzoate.
| Compound Name | [2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl] 2-chloro-5-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 16521159 |
| Molecular Formula | C23H23ClN2O6S |
| Molecular Weight | 490.97 g/mol |
| Exact Mass | 490.10 |
| IUPAC Name | [2-(7-ethyl-1H-indol-3-yl)-2-oxoethyl] 2-chloro-5-morpholin-4-ylsulfonylbenzoate |
| SMILES | CCc1cccc2c(C(=O)COC(=O)c3cc(S(=O)(=O)N4CCOCC4)ccc3Cl)c[nH]c12 |
| InChI | InChI=1S/C23H23ClN2O6S/c1-2-15-4-3-5-17-19(13-25-22(15)17)21(27)14-32-23(28)18-12-16(6-7-20(18)24)33(29,30)26-8-10-31-11-9-26/h3-7,12-13,25H,2,8-11,14H2,1H3 |
| InChIKey | VVTAXXGKMMJGIE-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 105.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.97 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |