C26H26N2O6S — CID 1040430
[3-[(4-methylbenzoyl)amino]phenyl] 4-methyl-3-morpholin-4-ylsulfonylbenzoate (PubChem CID 1040430) has the molecular formula C26H26N2O6S and a molecular weight of 494.57 g/mol. Its IUPAC name is [3-[(4-methylbenzoyl)amino]phenyl] 4-methyl-3-morpholin-4-ylsulfonylbenzoate.
| Compound Name | [3-[(4-methylbenzoyl)amino]phenyl] 4-methyl-3-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 1040430 |
| Molecular Formula | C26H26N2O6S |
| Molecular Weight | 494.57 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | [3-[(4-methylbenzoyl)amino]phenyl] 4-methyl-3-morpholin-4-ylsulfonylbenzoate |
| SMILES | Cc1ccc(C(=O)Nc2cccc(OC(=O)c3ccc(C)c(S(=O)(=O)N4CCOCC4)c3)c2)cc1 |
| InChI | InChI=1S/C26H26N2O6S/c1-18-6-9-20(10-7-18)25(29)27-22-4-3-5-23(17-22)34-26(30)21-11-8-19(2)24(16-21)35(31,32)28-12-14-33-15-13-28/h3-11,16-17H,12-15H2,1-2H3,(H,27,29) |
| InChIKey | HJZNNQLEKVXIRA-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.57 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|