C21H24BrN3O4S — CID 29333465
4-bromo-3-(dimethylsulfamoyl)-N-[[4-(pyrrolidine-1-carbonyl)phenyl]methyl]benzamide (PubChem CID 29333465) has the molecular formula C21H24BrN3O4S and a molecular weight of 494.41 g/mol. Its IUPAC name is 4-bromo-3-(dimethylsulfamoyl)-N-[[4-(pyrrolidine-1-carbonyl)phenyl]methyl]benzamide.
| Compound Name | 4-bromo-3-(dimethylsulfamoyl)-N-[[4-(pyrrolidine-1-carbonyl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 29333465 |
| Molecular Formula | C21H24BrN3O4S |
| Molecular Weight | 494.41 g/mol |
| Exact Mass | 493.07 |
| IUPAC Name | 4-bromo-3-(dimethylsulfamoyl)-N-[[4-(pyrrolidine-1-carbonyl)phenyl]methyl]benzamide |
| SMILES | CN(C)S(=O)(=O)c1cc(C(=O)NCc2ccc(C(=O)N3CCCC3)cc2)ccc1Br |
| InChI | InChI=1S/C21H24BrN3O4S/c1-24(2)30(28,29)19-13-17(9-10-18(19)22)20(26)23-14-15-5-7-16(8-6-15)21(27)25-11-3-4-12-25/h5-10,13H,3-4,11-12,14H2,1-2H3,(H,23,26) |
| InChIKey | MSGRRCYVDLBDCN-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.41 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |