C15H13N3O4S2 — CID 22774356
methyl 3-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-4-methylbenzoate (PubChem CID 22774356) has the molecular formula C15H13N3O4S2 and a molecular weight of 363.42 g/mol. Its IUPAC name is methyl 3-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-4-methylbenzoate.
| Compound Name | methyl 3-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-4-methylbenzoate |
|---|---|
| PubChem CID | 22774356 |
| Molecular Formula | C15H13N3O4S2 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.03 |
| IUPAC Name | methyl 3-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-4-methylbenzoate |
| SMILES | COC(=O)c1ccc(C)c(NS(=O)(=O)c2cccc3nsnc23)c1 |
| InChI | InChI=1S/C15H13N3O4S2/c1-9-6-7-10(15(19)22-2)8-12(9)18-24(20,21)13-5-3-4-11-14(13)17-23-16-11/h3-8,18H,1-2H3 |
| InChIKey | PKVQEZSGSWURJH-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diazox_sulfon_A(36)', 'substructure': 'N/A'} |
|---|