C16H15F2N3O3S — CID 134025769
1-cyclopropyl-3-[4-[(2,4-difluorophenyl)sulfonylamino]phenyl]urea (PubChem CID 134025769) has the molecular formula C16H15F2N3O3S and a molecular weight of 367.38 g/mol. Its IUPAC name is 1-cyclopropyl-3-[4-[(2,4-difluorophenyl)sulfonylamino]phenyl]urea.
| Compound Name | 1-cyclopropyl-3-[4-[(2,4-difluorophenyl)sulfonylamino]phenyl]urea |
|---|---|
| PubChem CID | 134025769 |
| Molecular Formula | C16H15F2N3O3S |
| Molecular Weight | 367.38 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | 1-cyclopropyl-3-[4-[(2,4-difluorophenyl)sulfonylamino]phenyl]urea |
| SMILES | O=C(Nc1ccc(NS(=O)(=O)c2ccc(F)cc2F)cc1)NC1CC1 |
| InChI | InChI=1S/C16H15F2N3O3S/c17-10-1-8-15(14(18)9-10)25(23,24)21-13-6-4-12(5-7-13)20-16(22)19-11-2-3-11/h1,4-9,11,21H,2-3H2,(H2,19,20,22) |
| InChIKey | INAFABYZGUAQJI-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.38 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |