C9H11F2NO2S — CID 47121816
N-[1-(3,4-difluorophenyl)ethyl]methanesulfonamide (PubChem CID 47121816) has the molecular formula C9H11F2NO2S and a molecular weight of 235.25 g/mol. Its IUPAC name is N-[1-(3,4-difluorophenyl)ethyl]methanesulfonamide.
| Compound Name | N-[1-(3,4-difluorophenyl)ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 47121816 |
| Molecular Formula | C9H11F2NO2S |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.05 |
| IUPAC Name | N-[1-(3,4-difluorophenyl)ethyl]methanesulfonamide |
| SMILES | CC(NS(C)(=O)=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C9H11F2NO2S/c1-6(12-15(2,13)14)7-3-4-8(10)9(11)5-7/h3-6,12H,1-2H3 |
| InChIKey | JYSZTYUAZGIYFG-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |