C17H19ClN2O3S — CID 55627714
N-[3-[1-[(5-chloro-2-methylphenyl)sulfonylamino]ethyl]phenyl]acetamide (PubChem CID 55627714) has the molecular formula C17H19ClN2O3S and a molecular weight of 366.87 g/mol. Its IUPAC name is N-[3-[1-[(5-chloro-2-methylphenyl)sulfonylamino]ethyl]phenyl]acetamide.
| Compound Name | N-[3-[1-[(5-chloro-2-methylphenyl)sulfonylamino]ethyl]phenyl]acetamide |
|---|---|
| PubChem CID | 55627714 |
| Molecular Formula | C17H19ClN2O3S |
| Molecular Weight | 366.87 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | N-[3-[1-[(5-chloro-2-methylphenyl)sulfonylamino]ethyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(C(C)NS(=O)(=O)c2cc(Cl)ccc2C)c1 |
| InChI | InChI=1S/C17H19ClN2O3S/c1-11-7-8-15(18)10-17(11)24(22,23)20-12(2)14-5-4-6-16(9-14)19-13(3)21/h4-10,12,20H,1-3H3,(H,19,21) |
| InChIKey | QAWVTTFSFNEPBX-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.87 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |