C16H14N2O4S — CID 168523061
phenyl 5-[(2-cyanoacetyl)amino]-2-methylbenzenesulfonate (PubChem CID 168523061) has the molecular formula C16H14N2O4S and a molecular weight of 330.37 g/mol. Its IUPAC name is phenyl 5-[(2-cyanoacetyl)amino]-2-methylbenzenesulfonate.
| Compound Name | phenyl 5-[(2-cyanoacetyl)amino]-2-methylbenzenesulfonate |
|---|---|
| PubChem CID | 168523061 |
| Molecular Formula | C16H14N2O4S |
| Molecular Weight | 330.37 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | phenyl 5-[(2-cyanoacetyl)amino]-2-methylbenzenesulfonate |
| SMILES | Cc1ccc(NC(=O)CC#N)cc1S(=O)(=O)Oc1ccccc1 |
| InChI | InChI=1S/C16H14N2O4S/c1-12-7-8-13(18-16(19)9-10-17)11-15(12)23(20,21)22-14-5-3-2-4-6-14/h2-8,11H,9H2,1H3,(H,18,19) |
| InChIKey | AOADPWKWMPZNGI-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.37 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|