C16H17NO5S — CID 35296433
(2,3,6-trimethylphenyl) 2-methyl-3-nitrobenzenesulfonate (PubChem CID 35296433) has the molecular formula C16H17NO5S and a molecular weight of 335.38 g/mol. Its IUPAC name is (2,3,6-trimethylphenyl) 2-methyl-3-nitrobenzenesulfonate.
| Compound Name | (2,3,6-trimethylphenyl) 2-methyl-3-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 35296433 |
| Molecular Formula | C16H17NO5S |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | (2,3,6-trimethylphenyl) 2-methyl-3-nitrobenzenesulfonate |
| SMILES | Cc1ccc(C)c(OS(=O)(=O)c2cccc([N+](=O)[O-])c2C)c1C |
| InChI | InChI=1S/C16H17NO5S/c1-10-8-9-11(2)16(12(10)3)22-23(20,21)15-7-5-6-14(13(15)4)17(18)19/h5-9H,1-4H3 |
| InChIKey | OIQNPKHIZFKXIR-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|