C12H6Br3NO5S — CID 138994821
(2,4,6-tribromophenyl) 2-nitrobenzenesulfonate (PubChem CID 138994821) has the molecular formula C12H6Br3NO5S and a molecular weight of 515.96 g/mol. Its IUPAC name is (2,4,6-tribromophenyl) 2-nitrobenzenesulfonate.
| Compound Name | (2,4,6-tribromophenyl) 2-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 138994821 |
| Molecular Formula | C12H6Br3NO5S |
| Molecular Weight | 515.96 g/mol |
| Exact Mass | 512.75 |
| IUPAC Name | (2,4,6-tribromophenyl) 2-nitrobenzenesulfonate |
| SMILES | O=[N+]([O-])c1ccccc1S(=O)(=O)Oc1c(Br)cc(Br)cc1Br |
| InChI | InChI=1S/C12H6Br3NO5S/c13-7-5-8(14)12(9(15)6-7)21-22(19,20)11-4-2-1-3-10(11)16(17)18/h1-6H |
| InChIKey | AEYFCHGPYSYYOJ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.96 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|