About (2-chloro-4-cyanophenyl) 2-nitrobenzenesulfonate
(2-chloro-4-cyanophenyl) 2-nitrobenzenesulfonate (PubChem CID 26531629) has the molecular formula C13H7ClN2O5S
and a molecular weight of 338.73 g/mol. Its IUPAC name is (2-chloro-4-cyanophenyl) 2-nitrobenzenesulfonate.
Molecular Properties
| Compound Name | (2-chloro-4-cyanophenyl) 2-nitrobenzenesulfonate |
| PubChem CID | 26531629 |
| Molecular Formula | C13H7ClN2O5S |
| Molecular Weight | 338.73 g/mol |
| Exact Mass | 337.98 |
| IUPAC Name | (2-chloro-4-cyanophenyl) 2-nitrobenzenesulfonate |
| SMILES | N#Cc1ccc(OS(=O)(=O)c2ccccc2[N+](=O)[O-])c(Cl)c1 |
| InChI | InChI=1S/C13H7ClN2O5S/c14-10-7-9(8-15)5-6-12(10)21-22(19,20)13-4-2-1-3-11(13)16(17)18/h1-7H |
| InChIKey | OUEDLXXQRIYITP-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 110.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.73 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (2-chloro-4-cyanophenyl) 2-nitrobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chloro-4-cyanophenyl) 2-nitrobenzenesulfonate?
The IUPAC name of (2-chloro-4-cyanophenyl) 2-nitrobenzenesulfonate (CID 26531629) is (2-chloro-4-cyanophenyl) 2-nitrobenzenesulfonate.
What is the SMILES notation for (2-chloro-4-cyanophenyl) 2-nitrobenzenesulfonate?
The canonical SMILES for (2-chloro-4-cyanophenyl) 2-nitrobenzenesulfonate is N#Cc1ccc(OS(=O)(=O)c2ccccc2[N+](=O)[O-])c(Cl)c1.
What is the InChIKey of (2-chloro-4-cyanophenyl) 2-nitrobenzenesulfonate?
The InChIKey is OUEDLXXQRIYITP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H7ClN2O5S/c14-10-7-9(8-15)5-6-12(10)21-22(19,20)13-4-2-1-3-11(13)16(17)18/h1-7H.
What are the key properties of (2-chloro-4-cyanophenyl) 2-nitrobenzenesulfonate?
(2-chloro-4-cyanophenyl) 2-nitrobenzenesulfonate has a molecular weight of 338.73 g/mol, XLogP of 2.89, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chloro-4-cyanophenyl) 2-nitrobenzenesulfonate is sourced from PubChem (CID 26531629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).