About (2-chloro-4-cyanophenyl) 5-chlorothiophene-2-sulfonate
(2-chloro-4-cyanophenyl) 5-chlorothiophene-2-sulfonate (PubChem CID 26531666) has the molecular formula C11H5Cl2NO3S2
and a molecular weight of 334.21 g/mol. Its IUPAC name is (2-chloro-4-cyanophenyl) 5-chlorothiophene-2-sulfonate.
Molecular Properties
| Compound Name | (2-chloro-4-cyanophenyl) 5-chlorothiophene-2-sulfonate |
| PubChem CID | 26531666 |
| Molecular Formula | C11H5Cl2NO3S2 |
| Molecular Weight | 334.21 g/mol |
| Exact Mass | 332.91 |
| IUPAC Name | (2-chloro-4-cyanophenyl) 5-chlorothiophene-2-sulfonate |
| SMILES | N#Cc1ccc(OS(=O)(=O)c2ccc(Cl)s2)c(Cl)c1 |
| InChI | InChI=1S/C11H5Cl2NO3S2/c12-8-5-7(6-14)1-2-9(8)17-19(15,16)11-4-3-10(13)18-11/h1-5H |
| InChIKey | SGLYJNNPECBUED-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.21 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (2-chloro-4-cyanophenyl) 5-chlorothiophene-2-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chloro-4-cyanophenyl) 5-chlorothiophene-2-sulfonate?
The IUPAC name of (2-chloro-4-cyanophenyl) 5-chlorothiophene-2-sulfonate (CID 26531666) is (2-chloro-4-cyanophenyl) 5-chlorothiophene-2-sulfonate.
What is the SMILES notation for (2-chloro-4-cyanophenyl) 5-chlorothiophene-2-sulfonate?
The canonical SMILES for (2-chloro-4-cyanophenyl) 5-chlorothiophene-2-sulfonate is N#Cc1ccc(OS(=O)(=O)c2ccc(Cl)s2)c(Cl)c1.
What is the InChIKey of (2-chloro-4-cyanophenyl) 5-chlorothiophene-2-sulfonate?
The InChIKey is SGLYJNNPECBUED-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H5Cl2NO3S2/c12-8-5-7(6-14)1-2-9(8)17-19(15,16)11-4-3-10(13)18-11/h1-5H.
What are the key properties of (2-chloro-4-cyanophenyl) 5-chlorothiophene-2-sulfonate?
(2-chloro-4-cyanophenyl) 5-chlorothiophene-2-sulfonate has a molecular weight of 334.21 g/mol, XLogP of 3.69, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chloro-4-cyanophenyl) 5-chlorothiophene-2-sulfonate is sourced from PubChem (CID 26531666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).