C7H5IN2O3S — CID 91245688
3-iodo-2H-indazole-5-sulfonic acid (PubChem CID 91245688) has the molecular formula C7H5IN2O3S and a molecular weight of 324.10 g/mol. Its IUPAC name is 3-iodo-2H-indazole-5-sulfonic acid.
| Compound Name | 3-iodo-2H-indazole-5-sulfonic acid |
|---|---|
| PubChem CID | 91245688 |
| Molecular Formula | C7H5IN2O3S |
| Molecular Weight | 324.10 g/mol |
| Exact Mass | 323.91 |
| IUPAC Name | 3-iodo-2H-indazole-5-sulfonic acid |
| SMILES | O=S(=O)(O)c1ccc2n[nH]c(I)c2c1 |
| InChI | InChI=1S/C7H5IN2O3S/c8-7-5-3-4(14(11,12)13)1-2-6(5)9-10-7/h1-3H,(H,9,10)(H,11,12,13) |
| InChIKey | GQYDIFRNXRLKEI-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 83.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.10 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|