C8H7N3O4S — CID 138745875
2-(nitrosomethyl)-3H-benzimidazole-5-sulfonic acid (PubChem CID 138745875) has the molecular formula C8H7N3O4S and a molecular weight of 241.23 g/mol. Its IUPAC name is 2-(nitrosomethyl)-3H-benzimidazole-5-sulfonic acid.
| Compound Name | 2-(nitrosomethyl)-3H-benzimidazole-5-sulfonic acid |
|---|---|
| PubChem CID | 138745875 |
| Molecular Formula | C8H7N3O4S |
| Molecular Weight | 241.23 g/mol |
| Exact Mass | 241.02 |
| IUPAC Name | 2-(nitrosomethyl)-3H-benzimidazole-5-sulfonic acid |
| SMILES | O=NCc1nc2ccc(S(=O)(=O)O)cc2[nH]1 |
| InChI | InChI=1S/C8H7N3O4S/c12-9-4-8-10-6-2-1-5(16(13,14)15)3-7(6)11-8/h1-3H,4H2,(H,10,11)(H,13,14,15) |
| InChIKey | QFRIRHTWYBHXQM-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 112.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.23 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|