C12H18N3NaO3S2 — CID 173408030
sodium;2-[2-(dimethylamino)ethylsulfanylmethyl]-3H-benzimidazole-5-sulfonic acid;hydride (PubChem CID 173408030) has the molecular formula C12H18N3NaO3S2 and a molecular weight of 339.42 g/mol. Its IUPAC name is sodium;2-[2-(dimethylamino)ethylsulfanylmethyl]-3H-benzimidazole-5-sulfonic acid;hydride.
| Compound Name | sodium;2-[2-(dimethylamino)ethylsulfanylmethyl]-3H-benzimidazole-5-sulfonic acid;hydride |
|---|---|
| PubChem CID | 173408030 |
| Molecular Formula | C12H18N3NaO3S2 |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | sodium;2-[2-(dimethylamino)ethylsulfanylmethyl]-3H-benzimidazole-5-sulfonic acid;hydride |
| SMILES | CN(C)CCSCc1nc2ccc(S(=O)(=O)O)cc2[nH]1.[H-].[Na+] |
| InChI | InChI=1S/C12H17N3O3S2.Na.H/c1-15(2)5-6-19-8-12-13-10-4-3-9(20(16,17)18)7-11(10)14-12;;/h3-4,7H,5-6,8H2,1-2H3,(H,13,14)(H,16,17,18);;/q;+1;-1 |
| InChIKey | BNEMUEWHLLOVCG-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 86.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|