C18H18N4O2S — CID 139799496
2-ethyl-6-[(2-ethyl-3H-benzimidazol-5-yl)sulfonyl]-1H-benzimidazole (PubChem CID 139799496) has the molecular formula C18H18N4O2S and a molecular weight of 354.44 g/mol. Its IUPAC name is 2-ethyl-6-[(2-ethyl-3H-benzimidazol-5-yl)sulfonyl]-1H-benzimidazole.
| Compound Name | 2-ethyl-6-[(2-ethyl-3H-benzimidazol-5-yl)sulfonyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 139799496 |
| Molecular Formula | C18H18N4O2S |
| Molecular Weight | 354.44 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 2-ethyl-6-[(2-ethyl-3H-benzimidazol-5-yl)sulfonyl]-1H-benzimidazole |
| SMILES | CCc1nc2ccc(S(=O)(=O)c3ccc4nc(CC)[nH]c4c3)cc2[nH]1 |
| InChI | InChI=1S/C18H18N4O2S/c1-3-17-19-13-7-5-11(9-15(13)21-17)25(23,24)12-6-8-14-16(10-12)22-18(4-2)20-14/h5-10H,3-4H2,1-2H3,(H,19,21)(H,20,22) |
| InChIKey | VLZQVZKCEVZAOW-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.44 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |