C9H11N3O2S — CID 60649079
2-ethyl-3H-benzimidazole-5-sulfonamide (PubChem CID 60649079) has the molecular formula C9H11N3O2S and a molecular weight of 225.27 g/mol. Its IUPAC name is 2-ethyl-3H-benzimidazole-5-sulfonamide.
| Compound Name | 2-ethyl-3H-benzimidazole-5-sulfonamide |
|---|---|
| PubChem CID | 60649079 |
| Molecular Formula | C9H11N3O2S |
| Molecular Weight | 225.27 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | 2-ethyl-3H-benzimidazole-5-sulfonamide |
| SMILES | CCc1nc2ccc(S(N)(=O)=O)cc2[nH]1 |
| InChI | InChI=1S/C9H11N3O2S/c1-2-9-11-7-4-3-6(15(10,13)14)5-8(7)12-9/h3-5H,2H2,1H3,(H,11,12)(H2,10,13,14) |
| InChIKey | WVNQPCZQJYVHGR-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 88.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.27 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |