C8H8N3O3S- — CID 153436267
2-(aminomethyl)-3H-benzimidazole-5-sulfonate (PubChem CID 153436267) has the molecular formula C8H8N3O3S- and a molecular weight of 226.24 g/mol. Its IUPAC name is 2-(aminomethyl)-3H-benzimidazole-5-sulfonate.
| Compound Name | 2-(aminomethyl)-3H-benzimidazole-5-sulfonate |
|---|---|
| PubChem CID | 153436267 |
| Molecular Formula | C8H8N3O3S- |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.03 |
| IUPAC Name | 2-(aminomethyl)-3H-benzimidazole-5-sulfonate |
| SMILES | NCc1nc2ccc(S(=O)(=O)[O-])cc2[nH]1 |
| InChI | InChI=1S/C8H9N3O3S/c9-4-8-10-6-2-1-5(15(12,13)14)3-7(6)11-8/h1-3H,4,9H2,(H,10,11)(H,12,13,14)/p-1 |
| InChIKey | ZBAHLTFFFAAOOV-UHFFFAOYSA-M |
| XLogP | -0.07 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|