C15H22N6OS — CID 13453091
(Z)-[1-amino-3-[[2-[(dimethylamino)methyl]-3H-benzimidazol-5-yl]methylsulfanyl]propylidene]urea (PubChem CID 13453091) has the molecular formula C15H22N6OS and a molecular weight of 334.45 g/mol. Its IUPAC name is (Z)-[1-amino-3-[[2-[(dimethylamino)methyl]-3H-benzimidazol-5-yl]methylsulfanyl]propylidene]urea.
| Compound Name | (Z)-[1-amino-3-[[2-[(dimethylamino)methyl]-3H-benzimidazol-5-yl]methylsulfanyl]propylidene]urea |
|---|---|
| PubChem CID | 13453091 |
| Molecular Formula | C15H22N6OS |
| Molecular Weight | 334.45 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | (Z)-[1-amino-3-[[2-[(dimethylamino)methyl]-3H-benzimidazol-5-yl]methylsulfanyl]propylidene]urea |
| SMILES | CN(C)Cc1nc2ccc(CSCC/C(N)=N/C(N)=O)cc2[nH]1 |
| InChI | InChI=1S/C15H22N6OS/c1-21(2)8-14-18-11-4-3-10(7-12(11)19-14)9-23-6-5-13(16)20-15(17)22/h3-4,7H,5-6,8-9H2,1-2H3,(H,18,19)(H4,16,17,20,22) |
| InChIKey | JGQCUQJNUAMYTI-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 113.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.45 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|