C12H15N3O2S — CID 43617726
methyl 3-[(6-amino-1H-benzimidazol-2-yl)methylsulfanyl]propanoate (PubChem CID 43617726) has the molecular formula C12H15N3O2S and a molecular weight of 265.34 g/mol. Its IUPAC name is methyl 3-[(6-amino-1H-benzimidazol-2-yl)methylsulfanyl]propanoate.
| Compound Name | methyl 3-[(6-amino-1H-benzimidazol-2-yl)methylsulfanyl]propanoate |
|---|---|
| PubChem CID | 43617726 |
| Molecular Formula | C12H15N3O2S |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | methyl 3-[(6-amino-1H-benzimidazol-2-yl)methylsulfanyl]propanoate |
| SMILES | COC(=O)CCSCc1nc2ccc(N)cc2[nH]1 |
| InChI | InChI=1S/C12H15N3O2S/c1-17-12(16)4-5-18-7-11-14-9-3-2-8(13)6-10(9)15-11/h2-3,6H,4-5,7,13H2,1H3,(H,14,15) |
| InChIKey | CPGYWKSDGXZCES-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|