C11H15NO3S — CID 43617731
methyl 3-[(5-amino-2-hydroxyphenyl)methylsulfanyl]propanoate (PubChem CID 43617731) has the molecular formula C11H15NO3S and a molecular weight of 241.31 g/mol. Its IUPAC name is methyl 3-[(5-amino-2-hydroxyphenyl)methylsulfanyl]propanoate.
| Compound Name | methyl 3-[(5-amino-2-hydroxyphenyl)methylsulfanyl]propanoate |
|---|---|
| PubChem CID | 43617731 |
| Molecular Formula | C11H15NO3S |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.08 |
| IUPAC Name | methyl 3-[(5-amino-2-hydroxyphenyl)methylsulfanyl]propanoate |
| SMILES | COC(=O)CCSCc1cc(N)ccc1O |
| InChI | InChI=1S/C11H15NO3S/c1-15-11(14)4-5-16-7-8-6-9(12)2-3-10(8)13/h2-3,6,13H,4-5,7,12H2,1H3 |
| InChIKey | XFVMPBDOBZKEJN-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|