C10H14N2O2S — CID 62466963
methyl 3-[(2-amino-3-pyridinyl)methylsulfanyl]propanoate (PubChem CID 62466963) has the molecular formula C10H14N2O2S and a molecular weight of 226.30 g/mol. Its IUPAC name is methyl 3-[(2-amino-3-pyridinyl)methylsulfanyl]propanoate.
| Compound Name | methyl 3-[(2-amino-3-pyridinyl)methylsulfanyl]propanoate |
|---|---|
| PubChem CID | 62466963 |
| Molecular Formula | C10H14N2O2S |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | methyl 3-[(2-amino-3-pyridinyl)methylsulfanyl]propanoate |
| SMILES | COC(=O)CCSCc1cccnc1N |
| InChI | InChI=1S/C10H14N2O2S/c1-14-9(13)4-6-15-7-8-3-2-5-12-10(8)11/h2-3,5H,4,6-7H2,1H3,(H2,11,12) |
| InChIKey | ZOBXZWANGPNRPA-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|