methyl 3-[(4-amino-2-methoxyphenyl)methylsulfanyl]propanoate

C12H17NO3S — CID 114112310

IUPACmethyl 3-[(4-amino-2-methoxyphenyl)methylsulfanyl]propanoate
SMILESCOC(=O)CCSCc1ccc(N)cc1OC
InChIInChI=1S/C12H17NO3S/c1-15-11-7-10(13)4-3-9(11)8-17-6-5-12(14)16-2/h3-4,7H,5-6,8,13H2,1-2H3
InChIKeyUAWKGBRCTFTART-UHFFFAOYSA-N
MW255.34 g/mol
LogP2.07
Rot. Bonds6

About methyl 3-[(4-amino-2-methoxyphenyl)methylsulfanyl]propanoate

methyl 3-[(4-amino-2-methoxyphenyl)methylsulfanyl]propanoate (PubChem CID 114112310) has the molecular formula C12H17NO3S and a molecular weight of 255.34 g/mol. Its IUPAC name is methyl 3-[(4-amino-2-methoxyphenyl)methylsulfanyl]propanoate.

Molecular Properties

Compound Namemethyl 3-[(4-amino-2-methoxyphenyl)methylsulfanyl]propanoate
PubChem CID114112310
Molecular FormulaC12H17NO3S
Molecular Weight255.34 g/mol
Exact Mass255.09
IUPAC Namemethyl 3-[(4-amino-2-methoxyphenyl)methylsulfanyl]propanoate
SMILESCOC(=O)CCSCc1ccc(N)cc1OC
InChIInChI=1S/C12H17NO3S/c1-15-11-7-10(13)4-3-9(11)8-17-6-5-12(14)16-2/h3-4,7H,5-6,8,13H2,1-2H3
InChIKeyUAWKGBRCTFTART-UHFFFAOYSA-N
XLogP2.07
TPSA61.55 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500255.34
LogP ≤ 52.07
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}

Analyze methyl 3-[(4-amino-2-methoxyphenyl)methylsulfanyl]propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-[(4-amino-2-methoxyphenyl)methylsulfanyl]propanoate?
The IUPAC name of methyl 3-[(4-amino-2-methoxyphenyl)methylsulfanyl]propanoate (CID 114112310) is methyl 3-[(4-amino-2-methoxyphenyl)methylsulfanyl]propanoate.
What is the SMILES notation for methyl 3-[(4-amino-2-methoxyphenyl)methylsulfanyl]propanoate?
The canonical SMILES for methyl 3-[(4-amino-2-methoxyphenyl)methylsulfanyl]propanoate is COC(=O)CCSCc1ccc(N)cc1OC.
What is the InChIKey of methyl 3-[(4-amino-2-methoxyphenyl)methylsulfanyl]propanoate?
The InChIKey is UAWKGBRCTFTART-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO3S/c1-15-11-7-10(13)4-3-9(11)8-17-6-5-12(14)16-2/h3-4,7H,5-6,8,13H2,1-2H3.
What are the key properties of methyl 3-[(4-amino-2-methoxyphenyl)methylsulfanyl]propanoate?
methyl 3-[(4-amino-2-methoxyphenyl)methylsulfanyl]propanoate has a molecular weight of 255.34 g/mol, XLogP of 2.07, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[(4-amino-2-methoxyphenyl)methylsulfanyl]propanoate is sourced from PubChem (CID 114112310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).