C14H20N2O4S — CID 43618313
ethyl 2-[3-(4-amino-2-methoxyanilino)-3-oxopropyl]sulfanylacetate (PubChem CID 43618313) has the molecular formula C14H20N2O4S and a molecular weight of 312.39 g/mol. Its IUPAC name is ethyl 2-[3-(4-amino-2-methoxyanilino)-3-oxopropyl]sulfanylacetate.
| Compound Name | ethyl 2-[3-(4-amino-2-methoxyanilino)-3-oxopropyl]sulfanylacetate |
|---|---|
| PubChem CID | 43618313 |
| Molecular Formula | C14H20N2O4S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | ethyl 2-[3-(4-amino-2-methoxyanilino)-3-oxopropyl]sulfanylacetate |
| SMILES | CCOC(=O)CSCCC(=O)Nc1ccc(N)cc1OC |
| InChI | InChI=1S/C14H20N2O4S/c1-3-20-14(18)9-21-7-6-13(17)16-11-5-4-10(15)8-12(11)19-2/h4-5,8H,3,6-7,9,15H2,1-2H3,(H,16,17) |
| InChIKey | ZVLMTBNPUAWRCT-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|