C12H15FN2O3S — CID 43617946
methyl 2-[3-(5-amino-2-fluoroanilino)-3-oxopropyl]sulfanylacetate (PubChem CID 43617946) has the molecular formula C12H15FN2O3S and a molecular weight of 286.33 g/mol. Its IUPAC name is methyl 2-[3-(5-amino-2-fluoroanilino)-3-oxopropyl]sulfanylacetate.
| Compound Name | methyl 2-[3-(5-amino-2-fluoroanilino)-3-oxopropyl]sulfanylacetate |
|---|---|
| PubChem CID | 43617946 |
| Molecular Formula | C12H15FN2O3S |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | methyl 2-[3-(5-amino-2-fluoroanilino)-3-oxopropyl]sulfanylacetate |
| SMILES | COC(=O)CSCCC(=O)Nc1cc(N)ccc1F |
| InChI | InChI=1S/C12H15FN2O3S/c1-18-12(17)7-19-5-4-11(16)15-10-6-8(14)2-3-9(10)13/h2-3,6H,4-5,7,14H2,1H3,(H,15,16) |
| InChIKey | OPNIOUCQUXDUGD-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|