C10H14N2O4S — CID 55213505
methyl 3-[[2-(hydrazinecarbonyl)furan-3-yl]methylsulfanyl]propanoate (PubChem CID 55213505) has the molecular formula C10H14N2O4S and a molecular weight of 258.30 g/mol. Its IUPAC name is methyl 3-[[2-(hydrazinecarbonyl)furan-3-yl]methylsulfanyl]propanoate.
| Compound Name | methyl 3-[[2-(hydrazinecarbonyl)furan-3-yl]methylsulfanyl]propanoate |
|---|---|
| PubChem CID | 55213505 |
| Molecular Formula | C10H14N2O4S |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | methyl 3-[[2-(hydrazinecarbonyl)furan-3-yl]methylsulfanyl]propanoate |
| SMILES | COC(=O)CCSCc1ccoc1C(=O)NN |
| InChI | InChI=1S/C10H14N2O4S/c1-15-8(13)3-5-17-6-7-2-4-16-9(7)10(14)12-11/h2,4H,3,5-6,11H2,1H3,(H,12,14) |
| InChIKey | ANQYYFVOTUSRIK-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|