C11H16N3P — CID 143719446
N,N-dimethyl-1-(6-methylphosphanyl-1H-benzimidazol-2-yl)methanamine (PubChem CID 143719446) has the molecular formula C11H16N3P and a molecular weight of 221.24 g/mol. Its IUPAC name is N,N-dimethyl-1-(6-methylphosphanyl-1H-benzimidazol-2-yl)methanamine.
| Compound Name | N,N-dimethyl-1-(6-methylphosphanyl-1H-benzimidazol-2-yl)methanamine |
|---|---|
| PubChem CID | 143719446 |
| Molecular Formula | C11H16N3P |
| Molecular Weight | 221.24 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | N,N-dimethyl-1-(6-methylphosphanyl-1H-benzimidazol-2-yl)methanamine |
| SMILES | CPc1ccc2nc(CN(C)C)[nH]c2c1 |
| InChI | InChI=1S/C11H16N3P/c1-14(2)7-11-12-9-5-4-8(15-3)6-10(9)13-11/h4-6,15H,7H2,1-3H3,(H,12,13) |
| InChIKey | AABHKTWGKFVTRR-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.24 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|