C12H16FN3O2S — CID 134698957
N-[(6-fluoro-1H-benzimidazol-2-yl)methyl]-N-methyl-2-methylsulfonylethanamine (PubChem CID 134698957) has the molecular formula C12H16FN3O2S and a molecular weight of 285.34 g/mol. Its IUPAC name is N-[(6-fluoro-1H-benzimidazol-2-yl)methyl]-N-methyl-2-methylsulfonylethanamine.
| Compound Name | N-[(6-fluoro-1H-benzimidazol-2-yl)methyl]-N-methyl-2-methylsulfonylethanamine |
|---|---|
| PubChem CID | 134698957 |
| Molecular Formula | C12H16FN3O2S |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | N-[(6-fluoro-1H-benzimidazol-2-yl)methyl]-N-methyl-2-methylsulfonylethanamine |
| SMILES | CN(CCS(C)(=O)=O)Cc1nc2ccc(F)cc2[nH]1 |
| InChI | InChI=1S/C12H16FN3O2S/c1-16(5-6-19(2,17)18)8-12-14-10-4-3-9(13)7-11(10)15-12/h3-4,7H,5-6,8H2,1-2H3,(H,14,15) |
| InChIKey | GBLQKBWYHCHOGT-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |